Products 1092978-76-1
CAS 1092978-76-1 is the registry number for 2-Diethylaminoethanol-d10 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 25mg.
2-[bis(1,1,2,2,2-pentadeuterioethyl)amino]ethanol;hydrochloride (CAS 1092978-76-1) is a chemical compound with the molecular formula C6H16ClNO and a molecular weight of 163.71 g/mol. IUPAC name: 2-[bis(1,1,2,2,2-pentadeuterioethyl)amino]ethanol;hydrochloride. InChIKey: DBQUKJMNGUJRFI-MFMGRUKYSA-N.
| Molecular formula | C6H16ClNO |
|---|---|
| Molecular weight | 163.71 g/mol |
| IUPAC name | 2-[bis(1,1,2,2,2-pentadeuterioethyl)amino]ethanol;hydrochloride |
| InChIKey | DBQUKJMNGUJRFI-MFMGRUKYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(CCO)C([2H])([2H])C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)