CAS 1093059-45-0 is the registry number for (3S,4S)-2,5-Dimethylhexane-3,4-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4S)-2,5-dimethylhexane-3,4-diamine (CAS 1093059-45-0) is a chemical compound with the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. IUPAC name: (3S,4S)-2,5-dimethylhexane-3,4-diamine. InChIKey: KQDYUNYMUMMKOL-YUMQZZPRSA-N.
| Molecular formula | C8H20N2 |
|---|---|
| Molecular weight | 144.26 g/mol |
| IUPAC name | (3S,4S)-2,5-dimethylhexane-3,4-diamine |
| InChIKey | KQDYUNYMUMMKOL-YUMQZZPRSA-N |
| SMILES | CC(C)[C@@H]([C@H](C(C)C)N)N |
Computed by PubChem (NCBI)