Products 109306-94-7
CAS 109306-94-7 is the registry number for LY 201409. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-amino-N-(2,6-dimethylphenyl)-3,5-dimethylbenzamide (CAS 109306-94-7) is a chemical compound with the molecular formula C17H20N2O and a molecular weight of 268.35 g/mol. IUPAC name: 4-amino-N-(2,6-dimethylphenyl)-3,5-dimethylbenzamide. InChIKey: ZSXGPMMRFFQFCH-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | 4-amino-N-(2,6-dimethylphenyl)-3,5-dimethylbenzamide |
| InChIKey | ZSXGPMMRFFQFCH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C2=CC(=C(C(=C2)C)N)C |
Computed by PubChem (NCBI)