CAS 1093380-13-2 appears in our catalog under these names: Olanzapine-d8, Olanzapine - d8, >95% (HPLC), Olanzapine–d8. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 500μg, 1 mg.
2-methyl-4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine (CAS 1093380-13-2) is a chemical compound with the molecular formula C17H20N4S and a molecular weight of 320.5 g/mol. IUPAC name: 2-methyl-4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine. InChIKey: KVWDHTXUZHCGIO-UFBJYANTSA-N.
| Molecular formula | C17H20N4S |
|---|---|
| Molecular weight | 320.5 g/mol |
| IUPAC name | 2-methyl-4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-10H-thieno[2,3-b][1,5]benzodiazepine |
| InChIKey | KVWDHTXUZHCGIO-UFBJYANTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1C)([2H])[2H])([2H])[2H])C2=NC3=CC=CC=C3NC4=C2C=C(S4)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)