Products 1093404-71-7

CAS 1093404-71-7 is the registry number for N-(2-Thienylcarbonyl)leucine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-methyl-2-(thiophene-2-carbonylamino)pentanoic acid;hydrochloride (CAS 1093404-71-7) is a chemical compound with the molecular formula C11H16ClNO3S and a molecular weight of 277.77 g/mol. IUPAC name: 4-methyl-2-(thiophene-2-carbonylamino)pentanoic acid;hydrochloride. InChIKey: YPAZYCIOCOJYPY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO3S
Molecular weight277.77 g/mol
IUPAC name4-methyl-2-(thiophene-2-carbonylamino)pentanoic acid;hydrochloride
InChIKeyYPAZYCIOCOJYPY-UHFFFAOYSA-N
SMILESCC(C)CC(C(=O)O)NC(=O)C1=CC=CS1.Cl

Computed by PubChem (NCBI)