CAS 109351-33-9 appears in our catalog under these names: (S)-Terazosin, 98%, (S)-Terazosin, (S)–Terazosin, 6,7-dimethoxy-2-{4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl}quinazolin-4-amine, 99.90%, 99.90%, (S)-Terazosin, 99.71%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 50mg, 2mg, 5mg, 100mg, 10mg, 10mM (in 1ml dmso), 100 mg, 10mM/1mL.
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone (CAS 109351-33-9) is a chemical compound with the molecular formula C19H25N5O4 and a molecular weight of 387.4 g/mol. IUPAC name: [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone. InChIKey: VCKUSRYTPJJLNI-AWEZNQCLSA-N.
| Molecular formula | C19H25N5O4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
| InChIKey | VCKUSRYTPJJLNI-AWEZNQCLSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCN(CC3)C(=O)[C@@H]4CCCO4)N)OC |
Computed by PubChem (NCBI)