CAS 1093656-34-8 appears in our catalog under these names: 2-Ethoxy-1-fluoro-4-nitrobenzene, 97%, 2–Ethoxy–1–fluoro–4–nitrobenzene, 2-Ethoxy-1-fluoro-4-nitrobenzene, 95%. Offered by: AmBeed, GLPBio, Fluorochem. Available pack sizes: 25g, 1g, 250mg, 5g.
2-ethoxy-1-fluoro-4-nitrobenzene (CAS 1093656-34-8) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 2-ethoxy-1-fluoro-4-nitrobenzene. InChIKey: NGMAAUCSJUUCRU-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 2-ethoxy-1-fluoro-4-nitrobenzene |
| InChIKey | NGMAAUCSJUUCRU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)