CAS 1093659-81-4 appears in our catalog under these names: 4–Fluoroaminobenzene–2,3,5,6–d4, 4-Fluoroaniline-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity. Offered by: GLPBio, CDN. Available pack sizes: 25mg, 5mg, 0,25g, 0,1g.
2,3,5,6-tetradeuterio-4-fluoroaniline (CAS 1093659-81-4) is a chemical compound with the molecular formula C6H6FN and a molecular weight of 115.14 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-fluoroaniline. InChIKey: KRZCOLNOCZKSDF-RHQRLBAQSA-N.
| Molecular formula | C6H6FN |
|---|---|
| Molecular weight | 115.14 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-fluoroaniline |
| InChIKey | KRZCOLNOCZKSDF-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)