Products 1093750-93-6

CAS 1093750-93-6 appears in our catalog under these names: 3-(Trifluoromethyl)cyclobutane-1-carboxylic acid, 95%, 3-(Trifluoromethyl)cyclobutanecarboxylic acid, 97%, 3-(Trifluoromethyl)cyclobutanecarboxylic acid, 3-(Trifluoromethyl)cyclobutanecarboxylic acid, 95%, 95%, 3-(Trifluoromethyl)cyclobutanecarboxylic acid, 98%+(GC-MS),RG. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 10g, 250mg, 2,5g, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

3-(trifluoromethyl)cyclobutane-1-carboxylic acid (CAS 1093750-93-6) is a chemical compound with the molecular formula C6H7F3O2 and a molecular weight of 168.11 g/mol. IUPAC name: 3-(trifluoromethyl)cyclobutane-1-carboxylic acid. InChIKey: ZSULKAPJHICPKB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7F3O2
Molecular weight168.11 g/mol
IUPAC name3-(trifluoromethyl)cyclobutane-1-carboxylic acid
InChIKeyZSULKAPJHICPKB-UHFFFAOYSA-N
SMILESC1C(CC1C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)