CAS 1093759-09-1 is the registry number for 1,1-Dimethylethyl 4-[[4-amino-3-(trifluoromethyl)phenyl]methyl]-1-piperazinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 4-[[4-amino-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (CAS 1093759-09-1) is a chemical compound with the molecular formula C17H24F3N3O2 and a molecular weight of 359.4 g/mol. IUPAC name: tert-butyl 4-[[4-amino-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate. InChIKey: JFTFRZVIGKMXCG-UHFFFAOYSA-N.
| Molecular formula | C17H24F3N3O2 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | tert-butyl 4-[[4-amino-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| InChIKey | JFTFRZVIGKMXCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC2=CC(=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)