CAS 1093871-50-1 appears in our catalog under these names: 5-Amino-1-methyl-3-iodo-1h-pyrazolo[3,4-b]pyridine, 95%, 3-Iodo-1-methyl-1H-pyrazolo[3,4-b]pyridin-5-amine, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
3-iodo-1-methylpyrazolo[5,4-b]pyridin-5-amine (CAS 1093871-50-1) is a chemical compound with the molecular formula C7H7IN4 and a molecular weight of 274.06 g/mol. IUPAC name: 3-iodo-1-methylpyrazolo[5,4-b]pyridin-5-amine. InChIKey: VFHDTXLRRMAKIV-UHFFFAOYSA-N.
| Molecular formula | C7H7IN4 |
|---|---|
| Molecular weight | 274.06 g/mol |
| IUPAC name | 3-iodo-1-methylpyrazolo[5,4-b]pyridin-5-amine |
| InChIKey | VFHDTXLRRMAKIV-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=N2)N)C(=N1)I |
Computed by PubChem (NCBI)