CAS 1093878-18-2 appears in our catalog under these names: 5–Bromo–2–nitrothiophene–3–carbaldehyde, 5-Bromo-2-nitrothiophene-3-carbaldehyde, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2-nitrothiophene-3-carbaldehyde (CAS 1093878-18-2) is a chemical compound with the molecular formula C5H2BrNO3S and a molecular weight of 236.05 g/mol. IUPAC name: 5-bromo-2-nitrothiophene-3-carbaldehyde. InChIKey: FSWWDXRRJRWFTC-UHFFFAOYSA-N.
| Molecular formula | C5H2BrNO3S |
|---|---|
| Molecular weight | 236.05 g/mol |
| IUPAC name | 5-bromo-2-nitrothiophene-3-carbaldehyde |
| InChIKey | FSWWDXRRJRWFTC-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1C=O)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)