Products 1093952-04-5
CAS 1093952-04-5 is the registry number for 5-Methyl-2(1H)-pyridinone-d6. Offered by: TRC. Available pack sizes: 100mg.
3,4,6-trideuterio-5-(trideuteriomethyl)-1H-pyridin-2-one (CAS 1093952-04-5) is a chemical compound with the molecular formula C6H7NO and a molecular weight of 115.16 g/mol. IUPAC name: 3,4,6-trideuterio-5-(trideuteriomethyl)-1H-pyridin-2-one. InChIKey: SOHMZGMHXUQHGE-RLTMCGQMSA-N.
| Molecular formula | C6H7NO |
|---|---|
| Molecular weight | 115.16 g/mol |
| IUPAC name | 3,4,6-trideuterio-5-(trideuteriomethyl)-1H-pyridin-2-one |
| InChIKey | SOHMZGMHXUQHGE-RLTMCGQMSA-N |
| SMILES | [2H]C1=C(C(=O)NC(=C1C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)