CAS 1093981-79-3 is the registry number for 2-Azido-N,N-bis(2-methylpropyl)acetamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-azido-N,N-bis(2-methylpropyl)acetamide (CAS 1093981-79-3) is a chemical compound with the molecular formula C10H20N4O and a molecular weight of 212.29 g/mol. IUPAC name: 2-azido-N,N-bis(2-methylpropyl)acetamide. InChIKey: ZQQQUZULOQGOPK-UHFFFAOYSA-N.
| Molecular formula | C10H20N4O |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 2-azido-N,N-bis(2-methylpropyl)acetamide |
| InChIKey | ZQQQUZULOQGOPK-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(C)C)C(=O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)