Products 1094100-06-7
CAS 1094100-06-7 appears in our catalog under these names: Rosuvastatin Impurity 153, (3R,5R)-Rosuvastatin, (3R,5R)-Rosuvastatin sodium salt. Offered by: Chemat Brand, MedChemExpress, Biosynth. Available pack sizes: on request, Get quote, 2mg, 1mg, 5mg, 10mg, 25mg.
(E,3R,5R)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid (CAS 1094100-06-7) is a chemical compound with the molecular formula C22H28FN3O6S and a molecular weight of 481.5 g/mol. IUPAC name: (E,3R,5R)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid. InChIKey: BPRHUIZQVSMCRT-YXWZHEERSA-N.
| Molecular formula | C22H28FN3O6S |
|---|---|
| Molecular weight | 481.5 g/mol |
| IUPAC name | (E,3R,5R)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoic acid |
| InChIKey | BPRHUIZQVSMCRT-YXWZHEERSA-N |
| SMILES | CC(C)C1=NC(=NC(=C1/C=C/[C@@H](C[C@H](CC(=O)O)O)O)C2=CC=C(C=C2)F)N(C)S(=O)(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Rosuvastatin diastereomers, Rosuvastatin diastereomers [USP], Rosuvastatin calcium impurity B [EP], ROSUVASTATIN DIASTEREOMER [USP IMPURITY], ROSUVASTATIN CALCIUM IMPURITY B [EP IMPURITY], Rosuvastatin diastereomers (USP), ROSUVASTATIN DIASTEREOMER (USP IMPURITY), ROSUVASTATIN CALCIUM IMPURITY B (EP IMPURITY), Rosuvastatin calcium impurity B, (3R,5R)-Rosuvastatin