CAS 1094106-58-7 appears in our catalog under these names: (E)-3-(3-Chloro-2-fluoro-6-(1H-tetrazol-1-yl)phenyl)acrylic acid, 90%, 90%, (E)-3-(3-Chloro-2-fluoro-6-(1H-tetrazol-1-yl)phenyl)acrylic acid, 95%, (E)-3-(3-Chloro-2-fluoro-6-(1H-tetrazol-1-yl)phenyl)acrylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoic acid (CAS 1094106-58-7) is a chemical compound with the molecular formula C10H6ClFN4O2 and a molecular weight of 268.63 g/mol. IUPAC name: (E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoic acid. InChIKey: YSAIHMUQKYDLSZ-DAFODLJHSA-N.
| Molecular formula | C10H6ClFN4O2 |
|---|---|
| Molecular weight | 268.63 g/mol |
| IUPAC name | (E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoic acid |
| InChIKey | YSAIHMUQKYDLSZ-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C(=C1N2C=NN=N2)/C=C/C(=O)O)F)Cl |
Computed by PubChem (NCBI)