CAS 1094203-41-4 is the registry number for 2-(Thiazol-2-yl)ethene-1-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-2-(1,3-thiazol-2-yl)ethenesulfonamide (CAS 1094203-41-4) is a chemical compound with the molecular formula C5H6N2O2S2 and a molecular weight of 190.2 g/mol. IUPAC name: (E)-2-(1,3-thiazol-2-yl)ethenesulfonamide. InChIKey: PGHAEEZPOUYNMQ-DAFODLJHSA-N.
| Molecular formula | C5H6N2O2S2 |
|---|---|
| Molecular weight | 190.2 g/mol |
| IUPAC name | (E)-2-(1,3-thiazol-2-yl)ethenesulfonamide |
| InChIKey | PGHAEEZPOUYNMQ-DAFODLJHSA-N |
| SMILES | C1=CSC(=N1)/C=C/S(=O)(=O)N |
Computed by PubChem (NCBI)