CAS 1094231-67-0 is the registry number for 5-(3-Chloro-4-fluorophenyl)-1,2,4-triazin-3-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-(3-chloro-4-fluorophenyl)-1,2,4-triazin-3-amine (CAS 1094231-67-0) is a chemical compound with the molecular formula C9H6ClFN4 and a molecular weight of 224.62 g/mol. IUPAC name: 5-(3-chloro-4-fluorophenyl)-1,2,4-triazin-3-amine. InChIKey: CARLIIWOEPGMMD-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN4 |
|---|---|
| Molecular weight | 224.62 g/mol |
| IUPAC name | 5-(3-chloro-4-fluorophenyl)-1,2,4-triazin-3-amine |
| InChIKey | CARLIIWOEPGMMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CN=NC(=N2)N)Cl)F |
Computed by PubChem (NCBI)