CAS 1094279-94-3 appears in our catalog under these names: 2-Bromo-6-(4-chlorophenyl)imidazo(2,1-b)(1,3,4)thiadiazole, 95%, 2-Bromo-6-(4-chlorophenyl)imidazo(2,1-b)(1,3,4)thiadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-bromo-6-(4-chlorophenyl)imidazo[2,1-b][1,3,4]thiadiazole (CAS 1094279-94-3) is a chemical compound with the molecular formula C10H5BrClN3S and a molecular weight of 314.59 g/mol. IUPAC name: 2-bromo-6-(4-chlorophenyl)imidazo[2,1-b][1,3,4]thiadiazole. InChIKey: HLJNVHZYIKUAMG-UHFFFAOYSA-N.
| Molecular formula | C10H5BrClN3S |
|---|---|
| Molecular weight | 314.59 g/mol |
| IUPAC name | 2-bromo-6-(4-chlorophenyl)imidazo[2,1-b][1,3,4]thiadiazole |
| InChIKey | HLJNVHZYIKUAMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C(=N2)SC(=N3)Br)Cl |
Computed by PubChem (NCBI)