Products 1094299-22-5
CAS 1094299-22-5 is the registry number for 9-Chloro-2,3,4,5-tetrahydrobenzo[b]oxepin-5-amine, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (CAS 1094299-22-5) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine. InChIKey: DYZOLKINGZEDSH-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| InChIKey | DYZOLKINGZEDSH-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C(=CC=C2)Cl)OC1)N |
Computed by PubChem (NCBI)