CAS 1094318-44-1 appears in our catalog under these names: 2-(1-Chloroethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole, 95%, 2-(1-Chloroethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(1-chloroethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole (CAS 1094318-44-1) is a chemical compound with the molecular formula C11H8Cl3NO and a molecular weight of 276.5 g/mol. IUPAC name: 2-(1-chloroethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole. InChIKey: CGRASENBOVUVIG-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl3NO |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | 2-(1-chloroethyl)-5-(3,4-dichlorophenyl)-1,3-oxazole |
| InChIKey | CGRASENBOVUVIG-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=C(O1)C2=CC(=C(C=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)