CAS 1094354-75-2 appears in our catalog under these names: 5-Phenyl-1-(2,2,2-trifluoroethyl)-1H-imidazole-2-thiol, 95%, 5-Phenyl-1-(2,2,2-trifluoroethyl)-1H-imidazole-2-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-phenyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione (CAS 1094354-75-2) is a chemical compound with the molecular formula C11H9F3N2S and a molecular weight of 258.26 g/mol. IUPAC name: 4-phenyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione. InChIKey: VGMDTVDXUFYCPS-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2S |
|---|---|
| Molecular weight | 258.26 g/mol |
| IUPAC name | 4-phenyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione |
| InChIKey | VGMDTVDXUFYCPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CNC(=S)N2CC(F)(F)F |
Computed by PubChem (NCBI)