CAS 1094393-84-6 is the registry number for 2,6-Dichloro-3-(propane-2-sulfonyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,6-dichloro-3-propan-2-ylsulfonylbenzoic acid (CAS 1094393-84-6) is a chemical compound with the molecular formula C10H10Cl2O4S and a molecular weight of 297.15 g/mol. IUPAC name: 2,6-dichloro-3-propan-2-ylsulfonylbenzoic acid. InChIKey: DXJSGBBYVJLJRY-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O4S |
|---|---|
| Molecular weight | 297.15 g/mol |
| IUPAC name | 2,6-dichloro-3-propan-2-ylsulfonylbenzoic acid |
| InChIKey | DXJSGBBYVJLJRY-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=C(C(=C(C=C1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)