CAS 1094403-82-3 is the registry number for 2-((2,2,2-Trifluoroethyl)sulfanyl)-5-(trifluoromethyl)aniline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2,2,2-trifluoroethylsulfanyl)-5-(trifluoromethyl)aniline (CAS 1094403-82-3) is a chemical compound with the molecular formula C9H7F6NS and a molecular weight of 275.22 g/mol. IUPAC name: 2-(2,2,2-trifluoroethylsulfanyl)-5-(trifluoromethyl)aniline. InChIKey: WMOKEFOPBRRXKH-UHFFFAOYSA-N.
| Molecular formula | C9H7F6NS |
|---|---|
| Molecular weight | 275.22 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethylsulfanyl)-5-(trifluoromethyl)aniline |
| InChIKey | WMOKEFOPBRRXKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)SCC(F)(F)F |
Computed by PubChem (NCBI)