Products 1094411-42-3
CAS 1094411-42-3 appears in our catalog under these names: 1-(3-Chloro-4-fluorophenyl)-5-methyl-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(3-Chloro-4-fluorophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylic acid (CAS 1094411-42-3) is a chemical compound with the molecular formula C10H7ClFN3O2 and a molecular weight of 255.63 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylic acid. InChIKey: NYUSHQHVBYUPLX-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFN3O2 |
|---|---|
| Molecular weight | 255.63 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)-5-methyltriazole-4-carboxylic acid |
| InChIKey | NYUSHQHVBYUPLX-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC(=C(C=C2)F)Cl)C(=O)O |
Computed by PubChem (NCBI)