CAS 1094440-66-0 appears in our catalog under these names: 5-(2,6-Difluorophenyl)thiophene-2-carboxylic acid, 95%, 5-(2,6-Difluorophenyl)thiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-(2,6-difluorophenyl)thiophene-2-carboxylic acid (CAS 1094440-66-0) is a chemical compound with the molecular formula C11H6F2O2S and a molecular weight of 240.23 g/mol. IUPAC name: 5-(2,6-difluorophenyl)thiophene-2-carboxylic acid. InChIKey: PUJMSPLQQOZPTJ-UHFFFAOYSA-N.
| Molecular formula | C11H6F2O2S |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | 5-(2,6-difluorophenyl)thiophene-2-carboxylic acid |
| InChIKey | PUJMSPLQQOZPTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=CC=C(S2)C(=O)O)F |
Computed by PubChem (NCBI)