Products 1094512-16-9

CAS 1094512-16-9 is the registry number for 4-(Pentyloxy)-3-(propan-2-yl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-pentoxy-3-propan-2-ylbenzenesulfonyl chloride (CAS 1094512-16-9) is a chemical compound with the molecular formula C14H21ClO3S and a molecular weight of 304.8 g/mol. IUPAC name: 4-pentoxy-3-propan-2-ylbenzenesulfonyl chloride. InChIKey: TWZKVAWLZZLAAX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21ClO3S
Molecular weight304.8 g/mol
IUPAC name4-pentoxy-3-propan-2-ylbenzenesulfonyl chloride
InChIKeyTWZKVAWLZZLAAX-UHFFFAOYSA-N
SMILESCCCCCOC1=C(C=C(C=C1)S(=O)(=O)Cl)C(C)C

Computed by PubChem (NCBI)