CAS 1094517-98-2 appears in our catalog under these names: Pregabalin Impurity 7 D-Tartrate, Pregabalin Diethylamide D-Tartrate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
(3S)-3-(aminomethyl)-N,N-diethyl-5-methylhexanamide;(2S,3S)-2,3-dihydroxybutanedioic acid (CAS 1094517-98-2) is a chemical compound with the molecular formula C16H32N2O7 and a molecular weight of 364.43 g/mol. IUPAC name: (3S)-3-(aminomethyl)-N,N-diethyl-5-methylhexanamide;(2S,3S)-2,3-dihydroxybutanedioic acid. InChIKey: FPUZNSRWGQAXSJ-RWALOXMOSA-N.
| Molecular formula | C16H32N2O7 |
|---|---|
| Molecular weight | 364.43 g/mol |
| IUPAC name | (3S)-3-(aminomethyl)-N,N-diethyl-5-methylhexanamide;(2S,3S)-2,3-dihydroxybutanedioic acid |
| InChIKey | FPUZNSRWGQAXSJ-RWALOXMOSA-N |
| SMILES | CCN(CC)C(=O)C[C@H](CC(C)C)CN.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)