Products 109462-43-3

CAS 109462-43-3 is the registry number for 2-[(2S)-oxiran-2-yl]acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2S)-oxiran-2-yl]acetic acid (CAS 109462-43-3) is a chemical compound with the molecular formula C4H6O3 and a molecular weight of 102.09 g/mol. IUPAC name: 2-[(2S)-oxiran-2-yl]acetic acid. InChIKey: ZVNYKZKUBKIIAH-VKHMYHEASA-N.

Identity
Molecular formulaC4H6O3
Molecular weight102.09 g/mol
IUPAC name2-[(2S)-oxiran-2-yl]acetic acid
InChIKeyZVNYKZKUBKIIAH-VKHMYHEASA-N
SMILESC1[C@@H](O1)CC(=O)O

Computed by PubChem (NCBI)