CAS 1094653-15-2 is the registry number for 3-(2-Bromophenyl)-5-methyl-4H-1,2,4-triazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(2-bromophenyl)-5-methyl-1H-1,2,4-triazole (CAS 1094653-15-2) is a chemical compound with the molecular formula C9H8BrN3 and a molecular weight of 238.08 g/mol. IUPAC name: 3-(2-bromophenyl)-5-methyl-1H-1,2,4-triazole. InChIKey: JAQOQUJKQHCSOM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3 |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 3-(2-bromophenyl)-5-methyl-1H-1,2,4-triazole |
| InChIKey | JAQOQUJKQHCSOM-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NN1)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)