CAS 1094755-66-4 appears in our catalog under these names: 3-Amino-1-(2,4,6-trichlorophenyl)urea, 95%, 3-Amino-1-(2,4,6-trichlorophenyl)urea. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-amino-3-(2,4,6-trichlorophenyl)urea (CAS 1094755-66-4) is a chemical compound with the molecular formula C7H6Cl3N3O and a molecular weight of 254.5 g/mol. IUPAC name: 1-amino-3-(2,4,6-trichlorophenyl)urea. InChIKey: LYZMZOMELGNPJN-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3N3O |
|---|---|
| Molecular weight | 254.5 g/mol |
| IUPAC name | 1-amino-3-(2,4,6-trichlorophenyl)urea |
| InChIKey | LYZMZOMELGNPJN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)NC(=O)NN)Cl)Cl |
Computed by PubChem (NCBI)