CAS 1094777-91-9 appears in our catalog under these names: 4-(Ethyl(methyl)amino)-N'-hydroxybenzene-1-carboximidamide, 95%, 4-(Ethyl(methyl)amino)-N'-hydroxybenzene-1-carboximidamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-[ethyl(methyl)amino]-N'-hydroxybenzenecarboximidamide (CAS 1094777-91-9) is a chemical compound with the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. IUPAC name: 4-[ethyl(methyl)amino]-N'-hydroxybenzenecarboximidamide. InChIKey: MAXZBKHCPSTDTP-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O |
|---|---|
| Molecular weight | 193.25 g/mol |
| IUPAC name | 4-[ethyl(methyl)amino]-N'-hydroxybenzenecarboximidamide |
| InChIKey | MAXZBKHCPSTDTP-UHFFFAOYSA-N |
| SMILES | CCN(C)C1=CC=C(C=C1)/C(=N/O)/N |
Computed by PubChem (NCBI)