Products 1094910-07-2
CAS 1094910-07-2 is the registry number for 5-Amino-2-chloro-N-ethyl-N-(propan-2-yl)benzamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-amino-2-chloro-N-ethyl-N-propan-2-ylbenzamide (CAS 1094910-07-2) is a chemical compound with the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. IUPAC name: 5-amino-2-chloro-N-ethyl-N-propan-2-ylbenzamide. InChIKey: ZIOOQQJCBHIGRE-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2O |
|---|---|
| Molecular weight | 240.73 g/mol |
| IUPAC name | 5-amino-2-chloro-N-ethyl-N-propan-2-ylbenzamide |
| InChIKey | ZIOOQQJCBHIGRE-UHFFFAOYSA-N |
| SMILES | CCN(C(C)C)C(=O)C1=C(C=CC(=C1)N)Cl |
Computed by PubChem (NCBI)