CAS 1094937-85-5 appears in our catalog under these names: 3-Fluoro-4-{(5-(trifluoromethyl)pyridin-2-yl)oxy}aniline, 95%, 3-Fluoro-4-{(5-(trifluoromethyl)pyridin-2-yl)oxy}aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]aniline (CAS 1094937-85-5) is a chemical compound with the molecular formula C12H8F4N2O and a molecular weight of 272.20 g/mol. IUPAC name: 3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]aniline. InChIKey: OCNQNARPBGMJRE-UHFFFAOYSA-N.
| Molecular formula | C12H8F4N2O |
|---|---|
| Molecular weight | 272.20 g/mol |
| IUPAC name | 3-fluoro-4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]aniline |
| InChIKey | OCNQNARPBGMJRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)F)OC2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)