Products 109515-15-3

CAS 109515-15-3 is the registry number for 2-Amino-1-(4-fluorophenyl)propan-1-ol. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 50mg, 0,5g, 0,25g, 1g, 5g, 2g.

Structural formula: {0} (CAS {1})

2-amino-1-(4-fluorophenyl)propan-1-ol (CAS 109515-15-3) is a chemical compound with the molecular formula C9H12FNO and a molecular weight of 169.20 g/mol. IUPAC name: 2-amino-1-(4-fluorophenyl)propan-1-ol. InChIKey: NFIUKBOGCIKNNF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12FNO
Molecular weight169.20 g/mol
IUPAC name2-amino-1-(4-fluorophenyl)propan-1-ol
InChIKeyNFIUKBOGCIKNNF-UHFFFAOYSA-N
SMILESCC(C(C1=CC=C(C=C1)F)O)N

Computed by PubChem (NCBI)