Products 1095177-31-3

CAS 1095177-31-3 appears in our catalog under these names: 3,5-Dibromothiophen-2-ylboronic acid, 97%, (3,5-Dibromothiophen-2-yl)boronic acid, 98+%, (3,5-Dibromothiophen-2-yl)boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(3,5-dibromothiophen-2-yl)boronic acid (CAS 1095177-31-3) is a chemical compound with the molecular formula C4H3BBr2O2S and a molecular weight of 285.75 g/mol. IUPAC name: (3,5-dibromothiophen-2-yl)boronic acid. InChIKey: OPWRTGBMXIXEAH-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3BBr2O2S
Molecular weight285.75 g/mol
IUPAC name(3,5-dibromothiophen-2-yl)boronic acid
InChIKeyOPWRTGBMXIXEAH-UHFFFAOYSA-N
SMILESB(C1=C(C=C(S1)Br)Br)(O)O

Computed by PubChem (NCBI)