Products 109523-92-4
CAS 109523-92-4 is the registry number for F-2875. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-but-2-enedioic acid;[4-(2-chlorophenyl)phenyl]methyl 2-imidazol-1-ylacetate (CAS 109523-92-4) is a chemical compound with the molecular formula C22H19ClN2O6 and a molecular weight of 442.8 g/mol. IUPAC name: (E)-but-2-enedioic acid;[4-(2-chlorophenyl)phenyl]methyl 2-imidazol-1-ylacetate. InChIKey: AOCKFAGJCCCUTQ-WLHGVMLRSA-N.
| Molecular formula | C22H19ClN2O6 |
|---|---|
| Molecular weight | 442.8 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;[4-(2-chlorophenyl)phenyl]methyl 2-imidazol-1-ylacetate |
| InChIKey | AOCKFAGJCCCUTQ-WLHGVMLRSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)COC(=O)CN3C=CN=C3)Cl.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)