CAS 1095493-96-1 appears in our catalog under these names: 2-(4-(Chloromethyl)phenyl)-5-methyl-1,3-benzothiazole, 95%, 2-(4-(Chloromethyl)phenyl)-5-methyl-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[4-(chloromethyl)phenyl]-5-methyl-1,3-benzothiazole (CAS 1095493-96-1) is a chemical compound with the molecular formula C15H12ClNS and a molecular weight of 273.8 g/mol. IUPAC name: 2-[4-(chloromethyl)phenyl]-5-methyl-1,3-benzothiazole. InChIKey: YAPJKMGSXVDYII-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNS |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | 2-[4-(chloromethyl)phenyl]-5-methyl-1,3-benzothiazole |
| InChIKey | YAPJKMGSXVDYII-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)SC(=N2)C3=CC=C(C=C3)CCl |
Computed by PubChem (NCBI)