CAS 1095565-68-6 appears in our catalog under these names: 3-{(2-(difluoromethoxy)phenyl)methoxy}benzoic acid, 95%, 3-{(2-(Difluoromethoxy)phenyl)methoxy}benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-[[2-(difluoromethoxy)phenyl]methoxy]benzoic acid (CAS 1095565-68-6) is a chemical compound with the molecular formula C15H12F2O4 and a molecular weight of 294.25 g/mol. IUPAC name: 3-[[2-(difluoromethoxy)phenyl]methoxy]benzoic acid. InChIKey: UGFHLOYCSQLPNJ-UHFFFAOYSA-N.
| Molecular formula | C15H12F2O4 |
|---|---|
| Molecular weight | 294.25 g/mol |
| IUPAC name | 3-[[2-(difluoromethoxy)phenyl]methoxy]benzoic acid |
| InChIKey | UGFHLOYCSQLPNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=CC(=C2)C(=O)O)OC(F)F |
Computed by PubChem (NCBI)