Products 1095706-65-2
CAS 1095706-65-2 is the registry number for Casein kinase 1δ-IN-27. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-fluorophenyl)-6-piperazin-1-yl-3-pyridin-4-ylimidazo[1,2-b]pyridazine (CAS 1095706-65-2) is a chemical compound with the molecular formula C21H19FN6 and a molecular weight of 374.4 g/mol. IUPAC name: 2-(4-fluorophenyl)-6-piperazin-1-yl-3-pyridin-4-ylimidazo[1,2-b]pyridazine. InChIKey: AHVJUQPLDYQRAX-UHFFFAOYSA-N.
| Molecular formula | C21H19FN6 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-6-piperazin-1-yl-3-pyridin-4-ylimidazo[1,2-b]pyridazine |
| InChIKey | AHVJUQPLDYQRAX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NN3C(=NC(=C3C4=CC=NC=C4)C5=CC=C(C=C5)F)C=C2 |
Computed by PubChem (NCBI)
Synonyms:
Casein kinase 1|A-IN-27, orb2944681