CAS 109589-98-2 is the registry number for 5-Bromoindolo[3,2,1-jk]carbazole, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
5-bromo-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene (CAS 109589-98-2) is a chemical compound with the molecular formula C18H10BrN and a molecular weight of 320.2 g/mol. IUPAC name: 5-bromo-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene. InChIKey: ZJIQJDUUTGPNKU-UHFFFAOYSA-N.
| Molecular formula | C18H10BrN |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | 5-bromo-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8,10,12(19),13,15,17-nonaene |
| InChIKey | ZJIQJDUUTGPNKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4N2C5=C(C4=CC=C3)C=C(C=C5)Br |
Computed by PubChem (NCBI)