CAS 1096143-75-7 appears in our catalog under these names: 1,3-Di-o-tert-butyldiphenylsilylglycerol, 95%, 1,3-di-O-tert-butyldiphenylsilylglycerol, 95%, 95%, 2,2,10,10-TETRAMETHYL-3,3,9,9-TETRAPHENYL-4,8-DIOXA-3,9-DISILAUNDECAN-6-OL, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-ol (CAS 1096143-75-7) is a chemical compound with the molecular formula C35H44O3Si2 and a molecular weight of 568.9 g/mol. IUPAC name: 1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-ol. InChIKey: SKXSFADJOJNBOU-UHFFFAOYSA-N.
| Molecular formula | C35H44O3Si2 |
|---|---|
| Molecular weight | 568.9 g/mol |
| IUPAC name | 1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-ol |
| InChIKey | SKXSFADJOJNBOU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCC(CO[Si](C3=CC=CC=C3)(C4=CC=CC=C4)C(C)(C)C)O |
Computed by PubChem (NCBI)