CAS 1096303-75-1 is the registry number for 2-(Benzyloxy)-3-bromo-5-fluoroaniline, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 500g, 5g, 1g.
3-bromo-5-fluoro-2-phenylmethoxyaniline (CAS 1096303-75-1) is a chemical compound with the molecular formula C13H11BrFNO and a molecular weight of 296.13 g/mol. IUPAC name: 3-bromo-5-fluoro-2-phenylmethoxyaniline. InChIKey: BRWDOSSHMJXEOM-UHFFFAOYSA-N.
| Molecular formula | C13H11BrFNO |
|---|---|
| Molecular weight | 296.13 g/mol |
| IUPAC name | 3-bromo-5-fluoro-2-phenylmethoxyaniline |
| InChIKey | BRWDOSSHMJXEOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Br)F)N |
Computed by PubChem (NCBI)