CAS 1096308-10-9 appears in our catalog under these names: 4-(8-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrrole-3-carboxylic acid, 95%, 4-(8-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrrole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1H-pyrrole-3-carboxylic acid (CAS 1096308-10-9) is a chemical compound with the molecular formula C13H10BrNO4 and a molecular weight of 324.13 g/mol. IUPAC name: 4-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1H-pyrrole-3-carboxylic acid. InChIKey: CTQZOJRETNUGLM-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO4 |
|---|---|
| Molecular weight | 324.13 g/mol |
| IUPAC name | 4-(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)-1H-pyrrole-3-carboxylic acid |
| InChIKey | CTQZOJRETNUGLM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C=C2Br)C3=CNC=C3C(=O)O |
Computed by PubChem (NCBI)