Products 1096319-05-9
CAS 1096319-05-9 is the registry number for {(2-(4-Chloro-2-methylphenoxy)-5-fluorophenyl)methyl}(methyl)amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-[2-(4-chloro-2-methylphenoxy)-5-fluorophenyl]-N-methylmethanamine (CAS 1096319-05-9) is a chemical compound with the molecular formula C15H15ClFNO and a molecular weight of 279.73 g/mol. IUPAC name: 1-[2-(4-chloro-2-methylphenoxy)-5-fluorophenyl]-N-methylmethanamine. InChIKey: HADCWTIIKDZGAX-UHFFFAOYSA-N.
| Molecular formula | C15H15ClFNO |
|---|---|
| Molecular weight | 279.73 g/mol |
| IUPAC name | 1-[2-(4-chloro-2-methylphenoxy)-5-fluorophenyl]-N-methylmethanamine |
| InChIKey | HADCWTIIKDZGAX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OC2=C(C=C(C=C2)F)CNC |
Computed by PubChem (NCBI)