CAS 1096802-82-2 is the registry number for 5-Methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzoic acid (CAS 1096802-82-2) is a chemical compound with the molecular formula C10H8F3NO6 and a molecular weight of 295.17 g/mol. IUPAC name: 5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: PLSRDXYNRAFFIL-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO6 |
|---|---|
| Molecular weight | 295.17 g/mol |
| IUPAC name | 5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | PLSRDXYNRAFFIL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OCC(F)(F)F |
Computed by PubChem (NCBI)