Products 1096802-82-2

CAS 1096802-82-2 is the registry number for 5-Methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzoic acid (CAS 1096802-82-2) is a chemical compound with the molecular formula C10H8F3NO6 and a molecular weight of 295.17 g/mol. IUPAC name: 5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: PLSRDXYNRAFFIL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8F3NO6
Molecular weight295.17 g/mol
IUPAC name5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzoic acid
InChIKeyPLSRDXYNRAFFIL-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OCC(F)(F)F

Computed by PubChem (NCBI)