CAS 1096827-19-8 is the registry number for 5-Methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzaldehyde (CAS 1096827-19-8) is a chemical compound with the molecular formula C10H8F3NO5 and a molecular weight of 279.17 g/mol. IUPAC name: 5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzaldehyde. InChIKey: NNFNWOPVAUSBFD-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO5 |
|---|---|
| Molecular weight | 279.17 g/mol |
| IUPAC name | 5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzaldehyde |
| InChIKey | NNFNWOPVAUSBFD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OCC(F)(F)F |
Computed by PubChem (NCBI)