Products 1096901-30-2

CAS 1096901-30-2 is the registry number for 2-Amino-5-(difluoromethoxy)-4-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-5-(difluoromethoxy)-4-methoxybenzoic acid (CAS 1096901-30-2) is a chemical compound with the molecular formula C9H9F2NO4 and a molecular weight of 233.17 g/mol. IUPAC name: 2-amino-5-(difluoromethoxy)-4-methoxybenzoic acid. InChIKey: NMVWLHHXAMIXCH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9F2NO4
Molecular weight233.17 g/mol
IUPAC name2-amino-5-(difluoromethoxy)-4-methoxybenzoic acid
InChIKeyNMVWLHHXAMIXCH-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)N)C(=O)O)OC(F)F

Computed by PubChem (NCBI)