CAS 1096934-22-3 appears in our catalog under these names: Bis(4-fluorophenyl)-1,2-oxazol-5-amine, 95%, Bis(4-fluorophenyl)-1,2-oxazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3,4-bis(4-fluorophenyl)-1,2-oxazol-5-amine (CAS 1096934-22-3) is a chemical compound with the molecular formula C15H10F2N2O and a molecular weight of 272.25 g/mol. IUPAC name: 3,4-bis(4-fluorophenyl)-1,2-oxazol-5-amine. InChIKey: CKUXCLFZYRVKNZ-UHFFFAOYSA-N.
| Molecular formula | C15H10F2N2O |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 3,4-bis(4-fluorophenyl)-1,2-oxazol-5-amine |
| InChIKey | CKUXCLFZYRVKNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(ON=C2C3=CC=C(C=C3)F)N)F |
Computed by PubChem (NCBI)