CAS 1096977-62-6 appears in our catalog under these names: 3-((2,6-Dimethylpiperidin-1-yl)sulfonyl)thiophene-2-carboxylic acid, 95%, 3-((2,6-Dimethylpiperidin-1-yl)sulfonyl)thiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(2,6-dimethylpiperidin-1-yl)sulfonylthiophene-2-carboxylic acid (CAS 1096977-62-6) is a chemical compound with the molecular formula C12H17NO4S2 and a molecular weight of 303.4 g/mol. IUPAC name: 3-(2,6-dimethylpiperidin-1-yl)sulfonylthiophene-2-carboxylic acid. InChIKey: GFTJFVJVDXRQCG-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 3-(2,6-dimethylpiperidin-1-yl)sulfonylthiophene-2-carboxylic acid |
| InChIKey | GFTJFVJVDXRQCG-UHFFFAOYSA-N |
| SMILES | CC1CCCC(N1S(=O)(=O)C2=C(SC=C2)C(=O)O)C |
Computed by PubChem (NCBI)